About 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide
3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide (PubChem CID 851296) has the molecular formula C12H13ClN2O2S
and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide.
Molecular Properties
| Compound Name | 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide |
| PubChem CID | 851296 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCSc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C12H13ClN2O2S/c1-2-14-11(16)5-6-18-12-15-9-7-8(13)3-4-10(9)17-12/h3-4,7H,2,5-6H2,1H3,(H,14,16) |
| InChIKey | GVNSPCFIUMYUGE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide?
The IUPAC name of 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide (CID 851296) is 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide.
What is the SMILES notation for 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide?
The canonical SMILES for 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide is CCNC(=O)CCSc1nc2cc(Cl)ccc2o1.
What is the InChIKey of 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide?
The InChIKey is GVNSPCFIUMYUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2S/c1-2-14-11(16)5-6-18-12-15-9-7-8(13)3-4-10(9)17-12/h3-4,7H,2,5-6H2,1H3,(H,14,16).
What are the key properties of 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide?
3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide has a molecular weight of 284.77 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-ethylpropanamide is sourced from PubChem (CID 851296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).