C10H11NO2 — CID 85132181
7-methyl-4a,6,7,8-tetrahydroquinoline-2,5-dione (PubChem CID 85132181) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 7-methyl-4a,6,7,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 7-methyl-4a,6,7,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 85132181 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 7-methyl-4a,6,7,8-tetrahydroquinoline-2,5-dione |
| SMILES | CC1CC(=O)C2C=CC(=O)N=C2C1 |
| InChI | InChI=1S/C10H11NO2/c1-6-4-8-7(9(12)5-6)2-3-10(13)11-8/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | SYGPDMVVYFVJLJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |