About 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole
2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole (PubChem CID 85132613) has the molecular formula C9H8S4
and a molecular weight of 244.43 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole.
Molecular Properties
| Compound Name | 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole |
| PubChem CID | 85132613 |
| Molecular Formula | C9H8S4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole |
| SMILES | CC=CC1=CSC(=C2SC=CS2)S1 |
| InChI | InChI=1S/C9H8S4/c1-2-3-7-6-12-9(13-7)8-10-4-5-11-8/h2-6H,1H3 |
| InChIKey | KRTGMZCYRDKOMC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole?
The IUPAC name of 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole (CID 85132613) is 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole.
What is the SMILES notation for 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole?
The canonical SMILES for 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole is CC=CC1=CSC(=C2SC=CS2)S1.
What is the InChIKey of 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole?
The InChIKey is KRTGMZCYRDKOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8S4/c1-2-3-7-6-12-9(13-7)8-10-4-5-11-8/h2-6H,1H3.
What are the key properties of 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole?
2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole has a molecular weight of 244.43 g/mol, XLogP of 4.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiol-2-ylidene)-4-prop-1-enyl-1,3-dithiole is sourced from PubChem (CID 85132613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).