About 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide
6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide (PubChem CID 85132665) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide.
Molecular Properties
| Compound Name | 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide |
| PubChem CID | 85132665 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C16H27NO/c1-5-9-17(10-6-2)15(18)13-8-7-12-11-14(13)16(12,3)4/h8,12,14H,5-7,9-11H2,1-4H3 |
| InChIKey | AAVVJFWFQCTTRO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide?
The IUPAC name of 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide (CID 85132665) is 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide.
What is the SMILES notation for 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide?
The canonical SMILES for 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide is CCCN(CCC)C(=O)C1=CCC2CC1C2(C)C.
What is the InChIKey of 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide?
The InChIKey is AAVVJFWFQCTTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-5-9-17(10-6-2)15(18)13-8-7-12-11-14(13)16(12,3)4/h8,12,14H,5-7,9-11H2,1-4H3.
What are the key properties of 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide?
6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide has a molecular weight of 249.40 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-N,N-dipropylbicyclo[3.1.1]hept-2-ene-2-carboxamide is sourced from PubChem (CID 85132665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).