C22H28FNOS — CID 8513553
2-(1-adamantylsulfanyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 8513553) has the molecular formula C22H28FNOS and a molecular weight of 373.54 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(1-adamantylsulfanyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8513553 |
| Molecular Formula | C22H28FNOS |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CSC12CC3CC(CC(C3)C1)C2)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C22H28FNOS/c23-20-4-2-1-3-18(20)13-24(19-5-6-19)21(25)14-26-22-10-15-7-16(11-22)9-17(8-15)12-22/h1-4,15-17,19H,5-14H2 |
| InChIKey | KYFAHSRJUWRKNW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |