About 3-hydroxyoctadeca-9,11-dienoic acid
3-hydroxyoctadeca-9,11-dienoic acid (PubChem CID 85139528) has the molecular formula C18H32O3
and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-hydroxyoctadeca-9,11-dienoic acid.
Molecular Properties
| Compound Name | 3-hydroxyoctadeca-9,11-dienoic acid |
| PubChem CID | 85139528 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 3-hydroxyoctadeca-9,11-dienoic acid |
| SMILES | CCCCCCC=CC=CCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21/h7-10,17,19H,2-6,11-16H2,1H3,(H,20,21) |
| InChIKey | IYQCNNKCGMGPGU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyoctadeca-9,11-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyoctadeca-9,11-dienoic acid?
The IUPAC name of 3-hydroxyoctadeca-9,11-dienoic acid (CID 85139528) is 3-hydroxyoctadeca-9,11-dienoic acid.
What is the SMILES notation for 3-hydroxyoctadeca-9,11-dienoic acid?
The canonical SMILES for 3-hydroxyoctadeca-9,11-dienoic acid is CCCCCCC=CC=CCCCCCC(O)CC(=O)O.
What is the InChIKey of 3-hydroxyoctadeca-9,11-dienoic acid?
The InChIKey is IYQCNNKCGMGPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21/h7-10,17,19H,2-6,11-16H2,1H3,(H,20,21).
What are the key properties of 3-hydroxyoctadeca-9,11-dienoic acid?
3-hydroxyoctadeca-9,11-dienoic acid has a molecular weight of 296.45 g/mol, XLogP of 4.86, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyoctadeca-9,11-dienoic acid is sourced from PubChem (CID 85139528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).