C22H19ClN2O4 — CID 8514063
(4-chlorophenyl)methyl (3aS)-1,5-dioxo-4-prop-2-enyl-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate (PubChem CID 8514063) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is (4-chlorophenyl)methyl (3aS)-1,5-dioxo-4-prop-2-enyl-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate.
| Compound Name | (4-chlorophenyl)methyl (3aS)-1,5-dioxo-4-prop-2-enyl-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate |
|---|---|
| PubChem CID | 8514063 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (4-chlorophenyl)methyl (3aS)-1,5-dioxo-4-prop-2-enyl-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxylate |
| SMILES | C=CCN1C(=O)c2ccccc2N2C(=O)CC[C@]12C(=O)OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClN2O4/c1-2-13-24-20(27)17-5-3-4-6-18(17)25-19(26)11-12-22(24,25)21(28)29-14-15-7-9-16(23)10-8-15/h2-10H,1,11-14H2/t22-/m0/s1 |
| InChIKey | VYSHRWDRUYUPIG-QFIPXVFZSA-N |
| XLogP | 3.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|