C8H12INO — CID 85145376
7-(iodomethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 85145376) has the molecular formula C8H12INO and a molecular weight of 265.09 g/mol. Its IUPAC name is 7-(iodomethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | 7-(iodomethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 85145376 |
| Molecular Formula | C8H12INO |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 7-(iodomethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1CCC2C(CI)CCN12 |
| InChI | InChI=1S/C8H12INO/c9-5-6-3-4-10-7(6)1-2-8(10)11/h6-7H,1-5H2 |
| InChIKey | AGOIQTQEFNGXNG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|