About but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate
but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate (PubChem CID 85145776) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate |
| PubChem CID | 85145776 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate |
| SMILES | C=CCCOC(=O)C(CC1CCc2ccccc2C1=O)=[N+]=[N-] |
| InChI | InChI=1S/C17H18N2O3/c1-2-3-10-22-17(21)15(19-18)11-13-9-8-12-6-4-5-7-14(12)16(13)20/h2,4-7,13H,1,3,8-11H2 |
| InChIKey | LWRMKXVFZCPRBA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate?
The IUPAC name of but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate (CID 85145776) is but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate.
What is the SMILES notation for but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate?
The canonical SMILES for but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate is C=CCCOC(=O)C(CC1CCc2ccccc2C1=O)=[N+]=[N-].
What is the InChIKey of but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate?
The InChIKey is LWRMKXVFZCPRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-2-3-10-22-17(21)15(19-18)11-13-9-8-12-6-4-5-7-14(12)16(13)20/h2,4-7,13H,1,3,8-11H2.
What are the key properties of but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate?
but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate has a molecular weight of 298.34 g/mol, XLogP of 2.61, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate is sourced from PubChem (CID 85145776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).