About N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide
N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide (PubChem CID 851471) has the molecular formula C11H11N3O4S
and a molecular weight of 281.29 g/mol. Its IUPAC name is N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide |
| PubChem CID | 851471 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11N3O4S/c1-7-9(10(15)13-11(16)12-7)14-19(17,18)8-5-3-2-4-6-8/h2-6,14H,1H3,(H2,12,13,15,16) |
| InChIKey | LXEANPCGBLLUHG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide?
The IUPAC name of N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide (CID 851471) is N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide.
What is the SMILES notation for N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide?
The canonical SMILES for N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide is Cc1[nH]c(=O)[nH]c(=O)c1NS(=O)(=O)c1ccccc1.
What is the InChIKey of N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide?
The InChIKey is LXEANPCGBLLUHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O4S/c1-7-9(10(15)13-11(16)12-7)14-19(17,18)8-5-3-2-4-6-8/h2-6,14H,1H3,(H2,12,13,15,16).
What are the key properties of N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide?
N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide has a molecular weight of 281.29 g/mol, XLogP of 0.17, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)benzenesulfonamide is sourced from PubChem (CID 851471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).