C23H21NO5 — CID 8514825
[(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 6-methyl-4-oxochromene-2-carboxylate (PubChem CID 8514825) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 6-methyl-4-oxochromene-2-carboxylate.
| Compound Name | [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 6-methyl-4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 8514825 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [(1R)-2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl] 6-methyl-4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc2oc(C(=O)O[C@@H](C(=O)N3CCCC3)c3ccccc3)cc(=O)c2c1 |
| InChI | InChI=1S/C23H21NO5/c1-15-9-10-19-17(13-15)18(25)14-20(28-19)23(27)29-21(16-7-3-2-4-8-16)22(26)24-11-5-6-12-24/h2-4,7-10,13-14,21H,5-6,11-12H2,1H3/t21-/m1/s1 |
| InChIKey | BJZKOJHUVISHBC-OAQYLSRUSA-N |
| XLogP | 3.62 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |