C34H45FN6O4S — CID 85149707
N-[3-(4-aminophenyl)-1-[4-(2-fluoroethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-[(1-morpholin-4-yl-3-phenylpropan-2-yl)amino]pyridine-3-sulfonamide (PubChem CID 85149707) has the molecular formula C34H45FN6O4S and a molecular weight of 652.84 g/mol. Its IUPAC name is N-[3-(4-aminophenyl)-1-[4-(2-fluoroethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-[(1-morpholin-4-yl-3-phenylpropan-2-yl)amino]pyridine-3-sulfonamide.
| Compound Name | N-[3-(4-aminophenyl)-1-[4-(2-fluoroethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-[(1-morpholin-4-yl-3-phenylpropan-2-yl)amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 85149707 |
| Molecular Formula | C34H45FN6O4S |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | N-[3-(4-aminophenyl)-1-[4-(2-fluoroethyl)piperidin-1-yl]-1-oxopropan-2-yl]-4-[(1-morpholin-4-yl-3-phenylpropan-2-yl)amino]pyridine-3-sulfonamide |
| SMILES | Nc1ccc(CC(NS(=O)(=O)c2cnccc2NC(Cc2ccccc2)CN2CCOCC2)C(=O)N2CCC(CCF)CC2)cc1 |
| InChI | InChI=1S/C34H45FN6O4S/c35-14-10-26-12-16-41(17-13-26)34(42)32(23-28-6-8-29(36)9-7-28)39-46(43,44)33-24-37-15-11-31(33)38-30(22-27-4-2-1-3-5-27)25-40-18-20-45-21-19-40/h1-9,11,15,24,26,30,32,39H,10,12-14,16-23,25,36H2,(H,37,38) |
| InChIKey | WDGJSLVWUQWGTB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|