C34H35ClF3N3O4S — CID 85149808
N-[(2-chlorophenyl)methyl]-N-cyclopropyl-3-methylsulfonyl-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide (PubChem CID 85149808) has the molecular formula C34H35ClF3N3O4S and a molecular weight of 674.19 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-N-cyclopropyl-3-methylsulfonyl-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-N-cyclopropyl-3-methylsulfonyl-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
|---|---|
| PubChem CID | 85149808 |
| Molecular Formula | C34H35ClF3N3O4S |
| Molecular Weight | 674.19 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-N-cyclopropyl-3-methylsulfonyl-7-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenyl]-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxamide |
| SMILES | CS(=O)(=O)N1CC2CC(c3ccc(CCCOc4c(F)ccc(F)c4F)cc3)=C(C(=O)N(Cc3ccccc3Cl)C3CC3)C(C1)N2 |
| InChI | InChI=1S/C34H35ClF3N3O4S/c1-46(43,44)40-19-24-17-26(22-10-8-21(9-11-22)5-4-16-45-33-29(37)15-14-28(36)32(33)38)31(30(20-40)39-24)34(42)41(25-12-13-25)18-23-6-2-3-7-27(23)35/h2-3,6-11,14-15,24-25,30,39H,4-5,12-13,16-20H2,1H3 |
| InChIKey | NMEXAUYTGUDVIE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.19 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|