C14H8N2O — CID 8515
14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (PubChem CID 8515) has the molecular formula C14H8N2O and a molecular weight of 220.23 g/mol. Its IUPAC name is 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one.
| Compound Name | 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 8515 |
| Molecular Formula | C14H8N2O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 14,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| SMILES | O=C1c2ccccc2-c2n[nH]c3cccc1c23 |
| InChI | InChI=1S/C14H8N2O/c17-14-9-5-2-1-4-8(9)13-12-10(14)6-3-7-11(12)15-16-13/h1-7H,(H,15,16) |
| InChIKey | ACPOUJIDANTYHO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |