About 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole
4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole (PubChem CID 85151240) has the molecular formula C8H8ClF3N2
and a molecular weight of 224.61 g/mol. Its IUPAC name is 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole.
Molecular Properties
| Compound Name | 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole |
| PubChem CID | 85151240 |
| Molecular Formula | C8H8ClF3N2 |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1c(C=CCl)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H8ClF3N2/c1-5-6(3-4-9)7(8(10,11)12)13-14(5)2/h3-4H,1-2H3 |
| InChIKey | FNDPPEVGUBHIQU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
The IUPAC name of 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole (CID 85151240) is 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole.
What is the SMILES notation for 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
The canonical SMILES for 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole is Cc1c(C=CCl)c(C(F)(F)F)nn1C.
What is the InChIKey of 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
The InChIKey is FNDPPEVGUBHIQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClF3N2/c1-5-6(3-4-9)7(8(10,11)12)13-14(5)2/h3-4H,1-2H3.
What are the key properties of 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole?
4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole has a molecular weight of 224.61 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethenyl)-1,5-dimethyl-3-(trifluoromethyl)pyrazole is sourced from PubChem (CID 85151240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).