C26H29ClN4O3 — CID 85154550
1-[4-[5-[3-(4-chlorophenyl)propoxy]-1-methylindol-3-yl]-1-hydroxybutan-2-yl]imidazole-4-carboxamide (PubChem CID 85154550) has the molecular formula C26H29ClN4O3 and a molecular weight of 481.00 g/mol. Its IUPAC name is 1-[4-[5-[3-(4-chlorophenyl)propoxy]-1-methylindol-3-yl]-1-hydroxybutan-2-yl]imidazole-4-carboxamide.
| Compound Name | 1-[4-[5-[3-(4-chlorophenyl)propoxy]-1-methylindol-3-yl]-1-hydroxybutan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 85154550 |
| Molecular Formula | C26H29ClN4O3 |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 1-[4-[5-[3-(4-chlorophenyl)propoxy]-1-methylindol-3-yl]-1-hydroxybutan-2-yl]imidazole-4-carboxamide |
| SMILES | Cn1cc(CCC(CO)n2cnc(C(N)=O)c2)c2cc(OCCCc3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C26H29ClN4O3/c1-30-14-19(6-9-21(16-32)31-15-24(26(28)33)29-17-31)23-13-22(10-11-25(23)30)34-12-2-3-18-4-7-20(27)8-5-18/h4-5,7-8,10-11,13-15,17,21,32H,2-3,6,9,12,16H2,1H3,(H2,28,33) |
| InChIKey | LOLFJCSELDRAPA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|