C14H16O2 — CID 85157533
4-prop-2-enyltetracyclo[6.3.0.02,6.05,9]undecane-3,11-dione (PubChem CID 85157533) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-prop-2-enyltetracyclo[6.3.0.02,6.05,9]undecane-3,11-dione.
| Compound Name | 4-prop-2-enyltetracyclo[6.3.0.02,6.05,9]undecane-3,11-dione |
|---|---|
| PubChem CID | 85157533 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4-prop-2-enyltetracyclo[6.3.0.02,6.05,9]undecane-3,11-dione |
| SMILES | C=CCC1C(=O)C2C3CC4C(CC(=O)C42)C13 |
| InChI | InChI=1S/C14H16O2/c1-2-3-6-11-8-5-10(15)12-7(8)4-9(11)13(12)14(6)16/h2,6-9,11-13H,1,3-5H2 |
| InChIKey | VTEDZUMASMEQND-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|