C12H19NO5 — CID 85158323
diethyl 2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate (PubChem CID 85158323) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is diethyl 2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate.
| Compound Name | diethyl 2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 85158323 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | diethyl 2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1ON2CCCC2C1C(=O)OCC |
| InChI | InChI=1S/C12H19NO5/c1-3-16-11(14)9-8-6-5-7-13(8)18-10(9)12(15)17-4-2/h8-10H,3-7H2,1-2H3 |
| InChIKey | JCAJWBRFGXVBHL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |