About [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol
[2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol (PubChem CID 85158381) has the molecular formula C9H6F6O2
and a molecular weight of 260.13 g/mol. Its IUPAC name is [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol |
| PubChem CID | 85158381 |
| Molecular Formula | C9H6F6O2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol |
| SMILES | OCC12C=CC(O1)C(C(F)(F)F)=C2C(F)(F)F |
| InChI | InChI=1S/C9H6F6O2/c10-8(11,12)5-4-1-2-7(3-16,17-4)6(5)9(13,14)15/h1-2,4,16H,3H2 |
| InChIKey | VGWMUWNEKIAEDW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol?
The IUPAC name of [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol (CID 85158381) is [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol.
What is the SMILES notation for [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol?
The canonical SMILES for [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol is OCC12C=CC(O1)C(C(F)(F)F)=C2C(F)(F)F.
What is the InChIKey of [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol?
The InChIKey is VGWMUWNEKIAEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F6O2/c10-8(11,12)5-4-1-2-7(3-16,17-4)6(5)9(13,14)15/h1-2,4,16H,3H2.
What are the key properties of [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol?
[2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol has a molecular weight of 260.13 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-dien-1-yl]methanol is sourced from PubChem (CID 85158381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).