About N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine
N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine (PubChem CID 85158503) has the molecular formula C17H15NO2
and a molecular weight of 265.31 g/mol. Its IUPAC name is N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine |
| PubChem CID | 85158503 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine |
| SMILES | ON=CC1=Cc2cccc(Oc3ccccc3)c2CC1 |
| InChI | InChI=1S/C17H15NO2/c19-18-12-13-9-10-16-14(11-13)5-4-8-17(16)20-15-6-2-1-3-7-15/h1-8,11-12,19H,9-10H2 |
| InChIKey | GWSUOGHXZQHCAU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine?
The IUPAC name of N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine (CID 85158503) is N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine.
What is the SMILES notation for N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine?
The canonical SMILES for N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine is ON=CC1=Cc2cccc(Oc3ccccc3)c2CC1.
What is the InChIKey of N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine?
The InChIKey is GWSUOGHXZQHCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO2/c19-18-12-13-9-10-16-14(11-13)5-4-8-17(16)20-15-6-2-1-3-7-15/h1-8,11-12,19H,9-10H2.
What are the key properties of N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine?
N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine has a molecular weight of 265.31 g/mol, XLogP of 4.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-phenoxy-3,4-dihydronaphthalen-2-yl)methylidene]hydroxylamine is sourced from PubChem (CID 85158503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).