About 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate
1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate (PubChem CID 85160727) has the molecular formula C17H26N2O4Si
and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate.
Molecular Properties
| Compound Name | 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate |
| PubChem CID | 85160727 |
| Molecular Formula | C17H26N2O4Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate |
| SMILES | C=C(O[Si](C)(C)C(C)(C)C)C(=[N+]=[N-])C(=O)OC(CC)c1ccoc1 |
| InChI | InChI=1S/C17H26N2O4Si/c1-8-14(13-9-10-21-11-13)22-16(20)15(19-18)12(2)23-24(6,7)17(3,4)5/h9-11,14H,2,8H2,1,3-7H3 |
| InChIKey | JNPXVBVWRMOKJA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 85.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate?
The IUPAC name of 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate (CID 85160727) is 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate.
What is the SMILES notation for 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate?
The canonical SMILES for 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate is C=C(O[Si](C)(C)C(C)(C)C)C(=[N+]=[N-])C(=O)OC(CC)c1ccoc1.
What is the InChIKey of 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate?
The InChIKey is JNPXVBVWRMOKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4Si/c1-8-14(13-9-10-21-11-13)22-16(20)15(19-18)12(2)23-24(6,7)17(3,4)5/h9-11,14H,2,8H2,1,3-7H3.
What are the key properties of 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate?
1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate has a molecular weight of 350.49 g/mol, XLogP of 4.48, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-yl)propyl 3-[tert-butyl(dimethyl)silyl]oxy-2-diazobut-3-enoate is sourced from PubChem (CID 85160727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).