C25H33NO10 — CID 85163928
[2,6,9,11,13,14-hexahydroxy-7-(hydroxymethyl)-3,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate (PubChem CID 85163928) has the molecular formula C25H33NO10 and a molecular weight of 507.54 g/mol. Its IUPAC name is [2,6,9,11,13,14-hexahydroxy-7-(hydroxymethyl)-3,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [2,6,9,11,13,14-hexahydroxy-7-(hydroxymethyl)-3,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 85163928 |
| Molecular Formula | C25H33NO10 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | [2,6,9,11,13,14-hexahydroxy-7-(hydroxymethyl)-3,10-dimethyl-11-propan-2-yl-15-oxapentacyclo[7.5.1.01,6.07,13.010,14]pentadec-3-en-12-yl] 1H-pyrrole-2-carboxylate |
| SMILES | CC1=CCC2(O)C3(CO)CC4(O)OC2(C1O)C1(O)C3(O)C(OC(=O)c2ccc[nH]2)C(O)(C(C)C)C41C |
| InChI | InChI=1S/C25H33NO10/c1-12(2)22(32)17(35-16(29)14-6-5-9-26-14)23(33)19(11-27)10-21(31)18(22,4)25(23,34)24(36-21)15(28)13(3)7-8-20(19,24)30/h5-7,9,12,15,17,26-28,30-34H,8,10-11H2,1-4H3 |
| InChIKey | LFYROHWJBCFUEX-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 192.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|