About 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione
3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (PubChem CID 85166730) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
Molecular Properties
| Compound Name | 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| PubChem CID | 85166730 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| SMILES | O=C1NN(CCO)C(=O)C2CC12 |
| InChI | InChI=1S/C7H10N2O3/c10-2-1-9-7(12)5-3-4(5)6(11)8-9/h4-5,10H,1-3H2,(H,8,11) |
| InChIKey | PTODREDTTXHPOH-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
The IUPAC name of 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (CID 85166730) is 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
What is the SMILES notation for 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
The canonical SMILES for 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione is O=C1NN(CCO)C(=O)C2CC12.
What is the InChIKey of 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
The InChIKey is PTODREDTTXHPOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c10-2-1-9-7(12)5-3-4(5)6(11)8-9/h4-5,10H,1-3H2,(H,8,11).
What are the key properties of 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione has a molecular weight of 170.17 g/mol, XLogP of -1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyethyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione is sourced from PubChem (CID 85166730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).