About 3-hydroxy-N-methoxy-N,2-dimethylpentanamide
3-hydroxy-N-methoxy-N,2-dimethylpentanamide (PubChem CID 85166766) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-hydroxy-N-methoxy-N,2-dimethylpentanamide.
Molecular Properties
| Compound Name | 3-hydroxy-N-methoxy-N,2-dimethylpentanamide |
| PubChem CID | 85166766 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3-hydroxy-N-methoxy-N,2-dimethylpentanamide |
| SMILES | CCC(O)C(C)C(=O)N(C)OC |
| InChI | InChI=1S/C8H17NO3/c1-5-7(10)6(2)8(11)9(3)12-4/h6-7,10H,5H2,1-4H3 |
| InChIKey | AMNAGDZXXCUJOS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-N-methoxy-N,2-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N-methoxy-N,2-dimethylpentanamide?
The IUPAC name of 3-hydroxy-N-methoxy-N,2-dimethylpentanamide (CID 85166766) is 3-hydroxy-N-methoxy-N,2-dimethylpentanamide.
What is the SMILES notation for 3-hydroxy-N-methoxy-N,2-dimethylpentanamide?
The canonical SMILES for 3-hydroxy-N-methoxy-N,2-dimethylpentanamide is CCC(O)C(C)C(=O)N(C)OC.
What is the InChIKey of 3-hydroxy-N-methoxy-N,2-dimethylpentanamide?
The InChIKey is AMNAGDZXXCUJOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-5-7(10)6(2)8(11)9(3)12-4/h6-7,10H,5H2,1-4H3.
What are the key properties of 3-hydroxy-N-methoxy-N,2-dimethylpentanamide?
3-hydroxy-N-methoxy-N,2-dimethylpentanamide has a molecular weight of 175.23 g/mol, XLogP of 0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N-methoxy-N,2-dimethylpentanamide is sourced from PubChem (CID 85166766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).