C19H27NO4Si — CID 85170546
methyl 3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-2,3,3a,4-tetrahydropyrrolo[1,2-a]indole-2-carboxylate (PubChem CID 85170546) has the molecular formula C19H27NO4Si and a molecular weight of 361.51 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-2,3,3a,4-tetrahydropyrrolo[1,2-a]indole-2-carboxylate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-2,3,3a,4-tetrahydropyrrolo[1,2-a]indole-2-carboxylate |
|---|---|
| PubChem CID | 85170546 |
| Molecular Formula | C19H27NO4Si |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-1-oxo-2,3,3a,4-tetrahydropyrrolo[1,2-a]indole-2-carboxylate |
| SMILES | COC(=O)C1C(=O)N2c3ccccc3CC2C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H27NO4Si/c1-19(2,3)25(5,6)24-16-14-11-12-9-7-8-10-13(12)20(14)17(21)15(16)18(22)23-4/h7-10,14-16H,11H2,1-6H3 |
| InChIKey | KXVNMZWSOCUMJM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|