C34H52O6 — CID 85174077
2-(3,15-diacetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methylhept-5-enoic acid (PubChem CID 85174077) has the molecular formula C34H52O6 and a molecular weight of 556.78 g/mol. Its IUPAC name is 2-(3,15-diacetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methylhept-5-enoic acid.
| Compound Name | 2-(3,15-diacetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 85174077 |
| Molecular Formula | C34H52O6 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | 2-(3,15-diacetyloxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-6-methylhept-5-enoic acid |
| SMILES | CC(=O)OC1CCC2(C)C3=C(CCC2C1(C)C)C1(C)C(OC(C)=O)CC(C(CCC=C(C)C)C(=O)O)C1(C)CC3 |
| InChI | InChI=1S/C34H52O6/c1-20(2)11-10-12-23(30(37)38)26-19-29(40-22(4)36)34(9)25-13-14-27-31(5,6)28(39-21(3)35)16-17-32(27,7)24(25)15-18-33(26,34)8/h11,23,26-29H,10,12-19H2,1-9H3,(H,37,38) |
| InChIKey | FRDFTEPTZCLNSB-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|