C40H36O9 — CID 85174912
2-[[2-(2,4-dihydroxyphenyl)-7-(3,7-dimethylocta-2,6-dienyl)-5,6-dihydroxy-1-benzofuran-3-yl]methyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol (PubChem CID 85174912) has the molecular formula C40H36O9 and a molecular weight of 660.72 g/mol. Its IUPAC name is 2-[[2-(2,4-dihydroxyphenyl)-7-(3,7-dimethylocta-2,6-dienyl)-5,6-dihydroxy-1-benzofuran-3-yl]methyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol.
| Compound Name | 2-[[2-(2,4-dihydroxyphenyl)-7-(3,7-dimethylocta-2,6-dienyl)-5,6-dihydroxy-1-benzofuran-3-yl]methyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
|---|---|
| PubChem CID | 85174912 |
| Molecular Formula | C40H36O9 |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 2-[[2-(2,4-dihydroxyphenyl)-7-(3,7-dimethylocta-2,6-dienyl)-5,6-dihydroxy-1-benzofuran-3-yl]methyl]-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| SMILES | CC(C)=CCCC(C)=CCc1c(O)c(O)cc2c(Cc3cc4c(cc3O)OCc3c-4oc4cc(O)ccc34)c(-c3ccc(O)cc3O)oc12 |
| InChI | InChI=1S/C40H36O9/c1-20(2)5-4-6-21(3)7-10-27-37(46)34(45)17-29-28(38(49-39(27)29)26-12-9-23(41)15-33(26)44)13-22-14-30-35(18-32(22)43)47-19-31-25-11-8-24(42)16-36(25)48-40(30)31/h5,7-9,11-12,14-18,41-46H,4,6,10,13,19H2,1-3H3 |
| InChIKey | DMXCZIUMBYRKQW-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|