C11H14O5 — CID 85176942
3-acetyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde (PubChem CID 85176942) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-acetyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde.
| Compound Name | 3-acetyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
|---|---|
| PubChem CID | 85176942 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-acetyl-1-methyl-8,9,10-trioxatricyclo[5.2.1.02,6]decane-4-carbaldehyde |
| SMILES | CC(=O)C1C(C=O)CC2C3OOC(C)(O3)C21 |
| InChI | InChI=1S/C11H14O5/c1-5(13)8-6(4-12)3-7-9(8)11(2)14-10(7)15-16-11/h4,6-10H,3H2,1-2H3 |
| InChIKey | QBPLITOVTODOJD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|