About 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole]
2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] (PubChem CID 85176971) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole].
Molecular Properties
| Compound Name | 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] |
| PubChem CID | 85176971 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] |
| SMILES | CCC1=Nc2ccccc2C12CCCCC2C |
| InChI | InChI=1S/C16H21N/c1-3-15-16(11-7-6-8-12(16)2)13-9-4-5-10-14(13)17-15/h4-5,9-10,12H,3,6-8,11H2,1-2H3 |
| InChIKey | XWCPXYIEFNPGFJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole]?
The IUPAC name of 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] (CID 85176971) is 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole].
What is the SMILES notation for 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole]?
The canonical SMILES for 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] is CCC1=Nc2ccccc2C12CCCCC2C.
What is the InChIKey of 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole]?
The InChIKey is XWCPXYIEFNPGFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N/c1-3-15-16(11-7-6-8-12(16)2)13-9-4-5-10-14(13)17-15/h4-5,9-10,12H,3,6-8,11H2,1-2H3.
What are the key properties of 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole]?
2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] has a molecular weight of 227.35 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-ethyl-2-methylspiro[cyclohexane-1,3'-indole] is sourced from PubChem (CID 85176971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).