About [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate
[2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate (PubChem CID 85178401) has the molecular formula C17H24O4
and a molecular weight of 292.38 g/mol. Its IUPAC name is [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate.
Molecular Properties
| Compound Name | [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate |
| PubChem CID | 85178401 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate |
| SMILES | CC(=O)OC(C=C(C)C)CC(C)=CCCC1=CC(=O)OC1 |
| InChI | InChI=1S/C17H24O4/c1-12(2)8-16(21-14(4)18)9-13(3)6-5-7-15-10-17(19)20-11-15/h6,8,10,16H,5,7,9,11H2,1-4H3 |
| InChIKey | XQRJJNVCCOFALB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate?
The IUPAC name of [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate (CID 85178401) is [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate.
What is the SMILES notation for [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate?
The canonical SMILES for [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate is CC(=O)OC(C=C(C)C)CC(C)=CCCC1=CC(=O)OC1.
What is the InChIKey of [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate?
The InChIKey is XQRJJNVCCOFALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4/c1-12(2)8-16(21-14(4)18)9-13(3)6-5-7-15-10-17(19)20-11-15/h6,8,10,16H,5,7,9,11H2,1-4H3.
What are the key properties of [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate?
[2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate has a molecular weight of 292.38 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-9-(5-oxo-2H-furan-3-yl)nona-2,6-dien-4-yl] acetate is sourced from PubChem (CID 85178401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).