C23H30O4 — CID 85180308
1-(2,4-dihydroxyphenyl)-3-ethenyl-3,7,11-trimethyldodeca-6,10-diene-1,9-dione (PubChem CID 85180308) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-ethenyl-3,7,11-trimethyldodeca-6,10-diene-1,9-dione.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-ethenyl-3,7,11-trimethyldodeca-6,10-diene-1,9-dione |
|---|---|
| PubChem CID | 85180308 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-ethenyl-3,7,11-trimethyldodeca-6,10-diene-1,9-dione |
| SMILES | C=CC(C)(CCC=C(C)CC(=O)C=C(C)C)CC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C23H30O4/c1-6-23(5,11-7-8-17(4)13-19(25)12-16(2)3)15-22(27)20-10-9-18(24)14-21(20)26/h6,8-10,12,14,24,26H,1,7,11,13,15H2,2-5H3 |
| InChIKey | QGXFRTQQPXHULK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|