About benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium
benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium (PubChem CID 85181625) has the molecular formula C19H29OS+
and a molecular weight of 305.51 g/mol. Its IUPAC name is benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium.
Molecular Properties
| Compound Name | benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium |
| PubChem CID | 85181625 |
| Molecular Formula | C19H29OS+ |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium |
| SMILES | COC1C([S+](C)Cc2ccccc2)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C19H29OS/c1-18(2)15-11-12-19(18,3)17(20-4)16(15)21(5)13-14-9-7-6-8-10-14/h6-10,15-17H,11-13H2,1-5H3/q+1 |
| InChIKey | ZGNVQNFUBHTKKN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium?
The IUPAC name of benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium (CID 85181625) is benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium.
What is the SMILES notation for benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium?
The canonical SMILES for benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium is COC1C([S+](C)Cc2ccccc2)C2CCC1(C)C2(C)C.
What is the InChIKey of benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium?
The InChIKey is ZGNVQNFUBHTKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29OS/c1-18(2)15-11-12-19(18,3)17(20-4)16(15)21(5)13-14-9-7-6-8-10-14/h6-10,15-17H,11-13H2,1-5H3/q+1.
What are the key properties of benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium?
benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium has a molecular weight of 305.51 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-(3-methoxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)-methylsulfanium is sourced from PubChem (CID 85181625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).