C14H24O2Si — CID 85186645
6-[2-(trimethylsilylmethyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 85186645) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is 6-[2-(trimethylsilylmethyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | 6-[2-(trimethylsilylmethyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 85186645 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 6-[2-(trimethylsilylmethyl)prop-2-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C=C(CC1CCC2CC(=O)OC12)C[Si](C)(C)C |
| InChI | InChI=1S/C14H24O2Si/c1-10(9-17(2,3)4)7-11-5-6-12-8-13(15)16-14(11)12/h11-12,14H,1,5-9H2,2-4H3 |
| InChIKey | YGFFYEHTPCNINJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|