About methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate
methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate (PubChem CID 851892) has the molecular formula C18H14N2O3S
and a molecular weight of 338.39 g/mol. Its IUPAC name is methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 851892 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C18H14N2O3S/c1-23-18(22)20-17-19-14(12-8-4-2-5-9-12)16(24-17)15(21)13-10-6-3-7-11-13/h2-11H,1H3,(H,19,20,22) |
| InChIKey | LEXZXNMSSMJPKV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate?
The IUPAC name of methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate (CID 851892) is methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate is COC(=O)Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1.
What is the InChIKey of methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate?
The InChIKey is LEXZXNMSSMJPKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3S/c1-23-18(22)20-17-19-14(12-8-4-2-5-9-12)16(24-17)15(21)13-10-6-3-7-11-13/h2-11H,1H3,(H,19,20,22).
What are the key properties of methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate?
methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate has a molecular weight of 338.39 g/mol, XLogP of 4.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(5-benzoyl-4-phenyl-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 851892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).