C17H31N — CID 85195968
N,N,3,7,11-pentamethyldodeca-2,6,10-trien-1-amine (PubChem CID 85195968) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is N,N,3,7,11-pentamethyldodeca-2,6,10-trien-1-amine.
| Compound Name | N,N,3,7,11-pentamethyldodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 85195968 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N,N,3,7,11-pentamethyldodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN(C)C |
| InChI | InChI=1S/C17H31N/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-18(5)6/h9,11,13H,7-8,10,12,14H2,1-6H3 |
| InChIKey | YDXHWMQMPARYTQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|