C19H31NO3 — CID 85197612
1-[2-(hydroxymethyl)pyrrolidin-1-yl]-8-methoxy-6-methyldodeca-2,4,6-trien-1-one (PubChem CID 85197612) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-8-methoxy-6-methyldodeca-2,4,6-trien-1-one.
| Compound Name | 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-8-methoxy-6-methyldodeca-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 85197612 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-[2-(hydroxymethyl)pyrrolidin-1-yl]-8-methoxy-6-methyldodeca-2,4,6-trien-1-one |
| SMILES | CCCCC(C=C(C)C=CC=CC(=O)N1CCCC1CO)OC |
| InChI | InChI=1S/C19H31NO3/c1-4-5-11-18(23-3)14-16(2)9-6-7-12-19(22)20-13-8-10-17(20)15-21/h6-7,9,12,14,17-18,21H,4-5,8,10-11,13,15H2,1-3H3 |
| InChIKey | XSMAAHDDIFGBIA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|