About [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate
[2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate (PubChem CID 8519816) has the molecular formula C13H15N3O5S
and a molecular weight of 325.35 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate.
Molecular Properties
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate |
| PubChem CID | 8519816 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate |
| SMILES | CNC(=O)COC(=O)CN(C)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H15N3O5S/c1-14-11(17)8-21-12(18)7-16(2)13-9-5-3-4-6-10(9)22(19,20)15-13/h3-6H,7-8H2,1-2H3,(H,14,17) |
| InChIKey | DSMBZNPLLITMSJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate?
The IUPAC name of [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate (CID 8519816) is [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate.
What is the SMILES notation for [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate?
The canonical SMILES for [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate is CNC(=O)COC(=O)CN(C)C1=NS(=O)(=O)c2ccccc21.
What is the InChIKey of [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate?
The InChIKey is DSMBZNPLLITMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O5S/c1-14-11(17)8-21-12(18)7-16(2)13-9-5-3-4-6-10(9)22(19,20)15-13/h3-6H,7-8H2,1-2H3,(H,14,17).
What are the key properties of [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate?
[2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate has a molecular weight of 325.35 g/mol, XLogP of -0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)-2-oxoethyl] 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]acetate is sourced from PubChem (CID 8519816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).