C24H15Cl2NO3 — CID 85200170
17-(2,6-dichlorophenyl)-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 85200170) has the molecular formula C24H15Cl2NO3 and a molecular weight of 436.29 g/mol. Its IUPAC name is 17-(2,6-dichlorophenyl)-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-(2,6-dichlorophenyl)-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 85200170 |
| Molecular Formula | C24H15Cl2NO3 |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 17-(2,6-dichlorophenyl)-1-hydroxy-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1C2C3c4ccccc4C(O)(c4ccccc43)C2C(=O)N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H15Cl2NO3/c25-16-10-5-11-17(26)21(16)27-22(28)19-18-12-6-1-3-8-14(12)24(30,20(19)23(27)29)15-9-4-2-7-13(15)18/h1-11,18-20,30H |
| InChIKey | UUYBSAXPYZNFFM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|