C28H38BrN3O7 — CID 85202313
6-[(3-bromo-4-hydroxyphenyl)methyl]-3,7,9,12,16,18-hexamethyl-14-methylidene-1-oxa-4,7,10-triazacyclooctadecane-2,5,8,11,15-pentone (PubChem CID 85202313) has the molecular formula C28H38BrN3O7 and a molecular weight of 608.53 g/mol. Its IUPAC name is 6-[(3-bromo-4-hydroxyphenyl)methyl]-3,7,9,12,16,18-hexamethyl-14-methylidene-1-oxa-4,7,10-triazacyclooctadecane-2,5,8,11,15-pentone.
| Compound Name | 6-[(3-bromo-4-hydroxyphenyl)methyl]-3,7,9,12,16,18-hexamethyl-14-methylidene-1-oxa-4,7,10-triazacyclooctadecane-2,5,8,11,15-pentone |
|---|---|
| PubChem CID | 85202313 |
| Molecular Formula | C28H38BrN3O7 |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | 6-[(3-bromo-4-hydroxyphenyl)methyl]-3,7,9,12,16,18-hexamethyl-14-methylidene-1-oxa-4,7,10-triazacyclooctadecane-2,5,8,11,15-pentone |
| SMILES | C=C1CC(C)C(=O)NC(C)C(=O)N(C)C(Cc2ccc(O)c(Br)c2)C(=O)NC(C)C(=O)OC(C)CC(C)C1=O |
| InChI | InChI=1S/C28H38BrN3O7/c1-14-10-16(3)25(35)30-18(5)27(37)32(7)22(13-20-8-9-23(33)21(29)12-20)26(36)31-19(6)28(38)39-17(4)11-15(2)24(14)34/h8-9,12,15-19,22,33H,1,10-11,13H2,2-7H3,(H,30,35)(H,31,36) |
| InChIKey | FQAPXMRHZCQORT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|