C11H18O2 — CID 85204053
4-methoxy-2,5-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 85204053) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | 4-methoxy-2,5-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 85204053 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 4-methoxy-2,5-dimethyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | COC1C(C)CC2C(=O)C(C)CC21 |
| InChI | InChI=1S/C11H18O2/c1-6-4-9-8(10(6)12)5-7(2)11(9)13-3/h6-9,11H,4-5H2,1-3H3 |
| InChIKey | LJOZGZCCXBBJQX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |