About 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one
4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one (PubChem CID 85204900) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one.
Molecular Properties
| Compound Name | 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one |
| PubChem CID | 85204900 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one |
| SMILES | C=C(C)C1CC(O)C2(C1)C(C)=CC(=O)C(O)C2C |
| InChI | InChI=1S/C15H22O3/c1-8(2)11-6-13(17)15(7-11)9(3)5-12(16)14(18)10(15)4/h5,10-11,13-14,17-18H,1,6-7H2,2-4H3 |
| InChIKey | BLDKDCBSDHBTFV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one?
The IUPAC name of 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one (CID 85204900) is 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one.
What is the SMILES notation for 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one?
The canonical SMILES for 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one is C=C(C)C1CC(O)C2(C1)C(C)=CC(=O)C(O)C2C.
What is the InChIKey of 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one?
The InChIKey is BLDKDCBSDHBTFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-8(2)11-6-13(17)15(7-11)9(3)5-12(16)14(18)10(15)4/h5,10-11,13-14,17-18H,1,6-7H2,2-4H3.
What are the key properties of 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one?
4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one has a molecular weight of 250.34 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydroxy-6,10-dimethyl-2-prop-1-en-2-ylspiro[4.5]dec-9-en-8-one is sourced from PubChem (CID 85204900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).