About N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide
N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide (PubChem CID 8520547) has the molecular formula C13H11Cl2N3O3S
and a molecular weight of 360.22 g/mol. Its IUPAC name is N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide |
| PubChem CID | 8520547 |
| Molecular Formula | C13H11Cl2N3O3S |
| Molecular Weight | 360.22 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)s1 |
| InChI | InChI=1S/C13H11Cl2N3O3S/c1-7(19)16-4-8-2-3-11(22-8)10(20)6-18-13(21)12(15)9(14)5-17-18/h2-3,5H,4,6H2,1H3,(H,16,19) |
| InChIKey | RIEZZOSVYYAEHB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide?
The IUPAC name of N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide (CID 8520547) is N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide.
What is the SMILES notation for N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide?
The canonical SMILES for N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide is CC(=O)NCc1ccc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)s1.
What is the InChIKey of N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide?
The InChIKey is RIEZZOSVYYAEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N3O3S/c1-7(19)16-4-8-2-3-11(22-8)10(20)6-18-13(21)12(15)9(14)5-17-18/h2-3,5H,4,6H2,1H3,(H,16,19).
What are the key properties of N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide?
N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide has a molecular weight of 360.22 g/mol, XLogP of 2.13, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]thiophen-2-yl]methyl]acetamide is sourced from PubChem (CID 8520547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).