C21H25ClN2 — CID 85206998
N,N-dibenzyl-4-chloro-3-prop-2-enyliminobutan-2-amine (PubChem CID 85206998) has the molecular formula C21H25ClN2 and a molecular weight of 340.90 g/mol. Its IUPAC name is N,N-dibenzyl-4-chloro-3-prop-2-enyliminobutan-2-amine.
| Compound Name | N,N-dibenzyl-4-chloro-3-prop-2-enyliminobutan-2-amine |
|---|---|
| PubChem CID | 85206998 |
| Molecular Formula | C21H25ClN2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N,N-dibenzyl-4-chloro-3-prop-2-enyliminobutan-2-amine |
| SMILES | C=CC/N=C(\CCl)C(C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25ClN2/c1-3-14-23-21(15-22)18(2)24(16-19-10-6-4-7-11-19)17-20-12-8-5-9-13-20/h3-13,18H,1,14-17H2,2H3/b23-21+ |
| InChIKey | LZCFXXVKYLXRDG-XTQSDGFTSA-N |
| XLogP | 4.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|