C19H31N3O3 — CID 8521753
N-methyl-N-(4-methylcyclohexyl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 8521753) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is N-methyl-N-(4-methylcyclohexyl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-methyl-N-(4-methylcyclohexyl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 8521753 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | N-methyl-N-(4-methylcyclohexyl)-2-[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CC1CCC(N(C)C(=O)CN2C(=O)N[C@]3(CCCC[C@H]3C)C2=O)CC1 |
| InChI | InChI=1S/C19H31N3O3/c1-13-7-9-15(10-8-13)21(3)16(23)12-22-17(24)19(20-18(22)25)11-5-4-6-14(19)2/h13-15H,4-12H2,1-3H3,(H,20,25)/t13?,14-,15?,19+/m1/s1 |
| InChIKey | ZAXUUGBUDFJIMT-QGQKBBJUSA-N |
| XLogP | 2.52 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|