C20H20FNO6 — CID 8521883
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate (PubChem CID 8521883) has the molecular formula C20H20FNO6 and a molecular weight of 389.38 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 8521883 |
| Molecular Formula | C20H20FNO6 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCN2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1F |
| InChI | InChI=1S/C20H20FNO6/c1-27-17-7-6-12(10-15(17)21)16(23)11-28-18(24)8-9-22-19(25)13-4-2-3-5-14(13)20(22)26/h2-3,6-7,10,13-14H,4-5,8-9,11H2,1H3/t13-,14+ |
| InChIKey | ZVXOBDYOSXMABV-OKILXGFUSA-N |
| XLogP | 1.90 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|