About ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate
ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate (PubChem CID 85219641) has the molecular formula C20H41IO6Si2
and a molecular weight of 560.62 g/mol. Its IUPAC name is ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate |
| PubChem CID | 85219641 |
| Molecular Formula | C20H41IO6Si2 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate |
| SMILES | CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(I)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H41IO6Si2/c1-14(26-28(8,9)10)15(27-29(11,12)13)20(21,16(22)24-18(2,3)4)17(23)25-19(5,6)7/h14-15H,1-13H3 |
| InChIKey | UDMNIPASXHQZGR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate?
The IUPAC name of ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate (CID 85219641) is ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate.
What is the SMILES notation for ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate?
The canonical SMILES for ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate is CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(I)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate?
The InChIKey is UDMNIPASXHQZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41IO6Si2/c1-14(26-28(8,9)10)15(27-29(11,12)13)20(21,16(22)24-18(2,3)4)17(23)25-19(5,6)7/h14-15H,1-13H3.
What are the key properties of ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate?
ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate has a molecular weight of 560.62 g/mol, XLogP of 5.30, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2-[1,2-bis(trimethylsilyloxy)propyl]-2-iodopropanedioate is sourced from PubChem (CID 85219641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).