About 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one
3-(1,2,3-trihydroxypropyl)-2H-furan-5-one (PubChem CID 85221597) has the molecular formula C7H10O5
and a molecular weight of 174.15 g/mol. Its IUPAC name is 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one |
| PubChem CID | 85221597 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one |
| SMILES | O=C1C=C(C(O)C(O)CO)CO1 |
| InChI | InChI=1S/C7H10O5/c8-2-5(9)7(11)4-1-6(10)12-3-4/h1,5,7-9,11H,2-3H2 |
| InChIKey | HGSNSVPUPKRBBJ-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one?
The IUPAC name of 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one (CID 85221597) is 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one.
What is the SMILES notation for 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one?
The canonical SMILES for 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one is O=C1C=C(C(O)C(O)CO)CO1.
What is the InChIKey of 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one?
The InChIKey is HGSNSVPUPKRBBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5/c8-2-5(9)7(11)4-1-6(10)12-3-4/h1,5,7-9,11H,2-3H2.
What are the key properties of 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one?
3-(1,2,3-trihydroxypropyl)-2H-furan-5-one has a molecular weight of 174.15 g/mol, XLogP of -1.82, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,3-trihydroxypropyl)-2H-furan-5-one is sourced from PubChem (CID 85221597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).