C19H22O3 — CID 85223537
[3-(2-hydroxy-3,4-dimethylphenyl)-3-phenylpropyl] acetate (PubChem CID 85223537) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is [3-(2-hydroxy-3,4-dimethylphenyl)-3-phenylpropyl] acetate.
| Compound Name | [3-(2-hydroxy-3,4-dimethylphenyl)-3-phenylpropyl] acetate |
|---|---|
| PubChem CID | 85223537 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | [3-(2-hydroxy-3,4-dimethylphenyl)-3-phenylpropyl] acetate |
| SMILES | CC(=O)OCCC(c1ccccc1)c1ccc(C)c(C)c1O |
| InChI | InChI=1S/C19H22O3/c1-13-9-10-18(19(21)14(13)2)17(11-12-22-15(3)20)16-7-5-4-6-8-16/h4-10,17,21H,11-12H2,1-3H3 |
| InChIKey | AKQGNIZCWKPELC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |