About 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene
1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene (PubChem CID 85223808) has the molecular formula C8H3BrF6O
and a molecular weight of 309.00 g/mol. Its IUPAC name is 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene.
Molecular Properties
| Compound Name | 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
| PubChem CID | 85223808 |
| Molecular Formula | C8H3BrF6O |
| Molecular Weight | 309.00 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2(Br)C=CC1O2 |
| InChI | InChI=1S/C8H3BrF6O/c9-6-2-1-3(16-6)4(7(10,11)12)5(6)8(13,14)15/h1-3H |
| InChIKey | BPKODAAKQAGIPQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.00 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene?
The IUPAC name of 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene (CID 85223808) is 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene.
What is the SMILES notation for 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene?
The canonical SMILES for 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene is FC(F)(F)C1=C(C(F)(F)F)C2(Br)C=CC1O2.
What is the InChIKey of 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene?
The InChIKey is BPKODAAKQAGIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrF6O/c9-6-2-1-3(16-6)4(7(10,11)12)5(6)8(13,14)15/h1-3H.
What are the key properties of 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene?
1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene has a molecular weight of 309.00 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,3-bis(trifluoromethyl)-7-oxabicyclo[2.2.1]hepta-2,5-diene is sourced from PubChem (CID 85223808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).