C18H15NO7 — CID 85224942
dimethyl 8,12-dioxo-16-oxa-9-azatetracyclo[11.2.1.01,9.02,7]hexadeca-2,4,6,14-tetraene-14,15-dicarboxylate (PubChem CID 85224942) has the molecular formula C18H15NO7 and a molecular weight of 357.32 g/mol. Its IUPAC name is dimethyl 8,12-dioxo-16-oxa-9-azatetracyclo[11.2.1.01,9.02,7]hexadeca-2,4,6,14-tetraene-14,15-dicarboxylate.
| Compound Name | dimethyl 8,12-dioxo-16-oxa-9-azatetracyclo[11.2.1.01,9.02,7]hexadeca-2,4,6,14-tetraene-14,15-dicarboxylate |
|---|---|
| PubChem CID | 85224942 |
| Molecular Formula | C18H15NO7 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | dimethyl 8,12-dioxo-16-oxa-9-azatetracyclo[11.2.1.01,9.02,7]hexadeca-2,4,6,14-tetraene-14,15-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C23OC1C(=O)CCN2C(=O)c1ccccc13 |
| InChI | InChI=1S/C18H15NO7/c1-24-16(22)12-13(17(23)25-2)18-10-6-4-3-5-9(10)15(21)19(18)8-7-11(20)14(12)26-18/h3-6,14H,7-8H2,1-2H3 |
| InChIKey | OERUSDRBKYFJHS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |